C9H12N2O7 — CID 21014625
(2,5-dioxopyrrolidin-1-yl) 2-(methoxymethoxycarbonylamino)acetate (PubChem CID 21014625) has the molecular formula C9H12N2O7 and a molecular weight of 260.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(methoxymethoxycarbonylamino)acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(methoxymethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 21014625 |
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(methoxymethoxycarbonylamino)acetate |
| SMILES | COCOC(=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H12N2O7/c1-16-5-17-9(15)10-4-8(14)18-11-6(12)2-3-7(11)13/h2-5H2,1H3,(H,10,15) |
| InChIKey | BRTKRABTKUVRQW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|