C10H16N3O6Y- — CID 169179109
[2-[[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]amino]-2-oxoethyl]azanide;ethanol;yttrium (PubChem CID 169179109) has the molecular formula C10H16N3O6Y- and a molecular weight of 363.16 g/mol. Its IUPAC name is [2-[[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]amino]-2-oxoethyl]azanide;ethanol;yttrium.
| Compound Name | [2-[[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]amino]-2-oxoethyl]azanide;ethanol;yttrium |
|---|---|
| PubChem CID | 169179109 |
| Molecular Formula | C10H16N3O6Y- |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [2-[[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]amino]-2-oxoethyl]azanide;ethanol;yttrium |
| SMILES | CCO.[NH-]CC(=O)NCC(=O)ON1C(=O)CCC1=O.[Y] |
| InChI | InChI=1S/C8H10N3O5.C2H6O.Y/c9-3-5(12)10-4-8(15)16-11-6(13)1-2-7(11)14;1-2-3;/h9H,1-4H2,(H,10,12);3H,2H2,1H3;/q-1;; |
| InChIKey | LPFMKPGXMFSALO-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|