C7H7BN2O5 — CID 20768516
CID 20768516 (PubChem CID 20768516) has the molecular formula C7H7BN2O5 and a molecular weight of 209.95 g/mol.
| Compound Name | CID 20768516 |
|---|---|
| PubChem CID | 20768516 |
| Molecular Formula | C7H7BN2O5 |
| Molecular Weight | 209.95 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C7H7BN2O5/c8-7(14)9-3-6(13)15-10-4(11)1-2-5(10)12/h1-3H2,(H,9,14) |
| InChIKey | JFJQOAKXGDUMCC-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.95 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|