C14H20N4O7S — CID 138700216
(2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-ethylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate (PubChem CID 138700216) has the molecular formula C14H20N4O7S and a molecular weight of 388.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-ethylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-ethylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 138700216 |
| Molecular Formula | C14H20N4O7S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-ethylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate |
| SMILES | CCSCC(=O)NCC(=O)NCC(=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H20N4O7S/c1-2-26-8-11(21)16-6-9(19)15-5-10(20)17-7-14(24)25-18-12(22)3-4-13(18)23/h2-8H2,1H3,(H,15,19)(H,16,21)(H,17,20) |
| InChIKey | OSWAYVUBKQWSOO-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|