C14H20N2O7S — CID 161498106
(2,5-dioxopyrrolidin-1-yl) 2-[3-(2-oxopentylsulfinyl)propanoylamino]acetate (PubChem CID 161498106) has the molecular formula C14H20N2O7S and a molecular weight of 360.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[3-(2-oxopentylsulfinyl)propanoylamino]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-(2-oxopentylsulfinyl)propanoylamino]acetate |
|---|---|
| PubChem CID | 161498106 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-(2-oxopentylsulfinyl)propanoylamino]acetate |
| SMILES | CCCC(=O)CS(=O)CCC(=O)NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H20N2O7S/c1-2-3-10(17)9-24(22)7-6-11(18)15-8-14(21)23-16-12(19)4-5-13(16)20/h2-9H2,1H3,(H,15,18) |
| InChIKey | NYESPJBRKFKBTO-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|