C19H30N4O8S — CID 144985124
(2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;pentane (PubChem CID 144985124) has the molecular formula C19H30N4O8S and a molecular weight of 474.54 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;pentane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;pentane |
|---|---|
| PubChem CID | 144985124 |
| Molecular Formula | C19H30N4O8S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[(2-acetylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate;pentane |
| SMILES | CC(=O)SCC(=O)NCC(=O)NCC(=O)NCC(=O)ON1C(=O)CCC1=O.CCCCC |
| InChI | InChI=1S/C14H18N4O8S.C5H12/c1-8(19)27-7-11(22)16-5-9(20)15-4-10(21)17-6-14(25)26-18-12(23)2-3-13(18)24;1-3-5-4-2/h2-7H2,1H3,(H,15,20)(H,16,22)(H,17,21);3-5H2,1-2H3 |
| InChIKey | GMOZHKNMUMZSRV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|