C30H31N3O6S2 — CID 143638608
(2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[[(5-methylcyclohexa-1,3-dien-1-yl)-diphenylmethyl]disulfanyl]acetyl]amino]acetyl]amino]acetate (PubChem CID 143638608) has the molecular formula C30H31N3O6S2 and a molecular weight of 593.73 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[[(5-methylcyclohexa-1,3-dien-1-yl)-diphenylmethyl]disulfanyl]acetyl]amino]acetyl]amino]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[[(5-methylcyclohexa-1,3-dien-1-yl)-diphenylmethyl]disulfanyl]acetyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 143638608 |
| Molecular Formula | C30H31N3O6S2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-[[2-[[(5-methylcyclohexa-1,3-dien-1-yl)-diphenylmethyl]disulfanyl]acetyl]amino]acetyl]amino]acetate |
| SMILES | CC1C=CC=C(C(SSCC(=O)NCC(=O)NCC(=O)ON2C(=O)CCC2=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C30H31N3O6S2/c1-21-9-8-14-24(17-21)30(22-10-4-2-5-11-22,23-12-6-3-7-13-23)41-40-20-26(35)31-18-25(34)32-19-29(38)39-33-27(36)15-16-28(33)37/h2-14,21H,15-20H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | MRGGCPIMOMNRAE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|