C16H16IN3O7 — CID 88653596
(3-iodo-2,5-dioxopyrrolidin-1-yl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate (PubChem CID 88653596) has the molecular formula C16H16IN3O7 and a molecular weight of 489.22 g/mol. Its IUPAC name is (3-iodo-2,5-dioxopyrrolidin-1-yl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate.
| Compound Name | (3-iodo-2,5-dioxopyrrolidin-1-yl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 88653596 |
| Molecular Formula | C16H16IN3O7 |
| Molecular Weight | 489.22 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | (3-iodo-2,5-dioxopyrrolidin-1-yl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCC(=O)ON1C(=O)CC(I)C1=O |
| InChI | InChI=1S/C16H16IN3O7/c17-11-6-13(22)20(15(11)24)27-14(23)8-18-12(21)7-19-16(25)26-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,18,21)(H,19,25) |
| InChIKey | FXEDSIJPVNFVNK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|