About 2-(methylamino)ethyl 2-methoxyacetate
2-(methylamino)ethyl 2-methoxyacetate (PubChem CID 23093561) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 2-(methylamino)ethyl 2-methoxyacetate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl 2-methoxyacetate |
| PubChem CID | 23093561 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 2-(methylamino)ethyl 2-methoxyacetate |
| SMILES | CNCCOC(=O)COC |
| InChI | InChI=1S/C6H13NO3/c1-7-3-4-10-6(8)5-9-2/h7H,3-5H2,1-2H3 |
| InChIKey | GVBVVKJPNJOVCD-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl 2-methoxyacetate?
The IUPAC name of 2-(methylamino)ethyl 2-methoxyacetate (CID 23093561) is 2-(methylamino)ethyl 2-methoxyacetate.
What is the SMILES notation for 2-(methylamino)ethyl 2-methoxyacetate?
The canonical SMILES for 2-(methylamino)ethyl 2-methoxyacetate is CNCCOC(=O)COC.
What is the InChIKey of 2-(methylamino)ethyl 2-methoxyacetate?
The InChIKey is GVBVVKJPNJOVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-7-3-4-10-6(8)5-9-2/h7H,3-5H2,1-2H3.
What are the key properties of 2-(methylamino)ethyl 2-methoxyacetate?
2-(methylamino)ethyl 2-methoxyacetate has a molecular weight of 147.17 g/mol, XLogP of -0.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl 2-methoxyacetate is sourced from PubChem (CID 23093561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).