C15H22O11 — CID 176759680
[1-oxo-1-[2-[2-oxo-2-(2-oxopropoxy)ethoxy]carbonyloxyethoxy]propan-2-yl] 2-methoxypropanoate (PubChem CID 176759680) has the molecular formula C15H22O11 and a molecular weight of 378.33 g/mol. Its IUPAC name is [1-oxo-1-[2-[2-oxo-2-(2-oxopropoxy)ethoxy]carbonyloxyethoxy]propan-2-yl] 2-methoxypropanoate.
| Compound Name | [1-oxo-1-[2-[2-oxo-2-(2-oxopropoxy)ethoxy]carbonyloxyethoxy]propan-2-yl] 2-methoxypropanoate |
|---|---|
| PubChem CID | 176759680 |
| Molecular Formula | C15H22O11 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [1-oxo-1-[2-[2-oxo-2-(2-oxopropoxy)ethoxy]carbonyloxyethoxy]propan-2-yl] 2-methoxypropanoate |
| SMILES | COC(C)C(=O)OC(C)C(=O)OCCOC(=O)OCC(=O)OCC(C)=O |
| InChI | InChI=1S/C15H22O11/c1-9(16)7-24-12(17)8-25-15(20)23-6-5-22-13(18)11(3)26-14(19)10(2)21-4/h10-11H,5-8H2,1-4H3 |
| InChIKey | PHVPZHXVENWUBR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|