C13H22O6 — CID 158022091
2-oxopropyl 2-[3-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoate (PubChem CID 158022091) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-oxopropyl 2-[3-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoate.
| Compound Name | 2-oxopropyl 2-[3-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoate |
|---|---|
| PubChem CID | 158022091 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-oxopropyl 2-[3-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoate |
| SMILES | CC(=O)COC(=O)C(C)OC(=O)CCOC(C)(C)C |
| InChI | InChI=1S/C13H22O6/c1-9(14)8-17-12(16)10(2)19-11(15)6-7-18-13(3,4)5/h10H,6-8H2,1-5H3 |
| InChIKey | XOBYPGSHICVHCG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |