About [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate
[4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate (PubChem CID 157461813) has the molecular formula C13H22O5
and a molecular weight of 258.31 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate |
| PubChem CID | 157461813 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OC(C)C(=O)COC(C)(C)C |
| InChI | InChI=1S/C13H22O5/c1-9(14)6-7-12(16)18-10(2)11(15)8-17-13(3,4)5/h10H,6-8H2,1-5H3 |
| InChIKey | BDBQSYVRBVTDBY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate?
The IUPAC name of [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate (CID 157461813) is [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate.
What is the SMILES notation for [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate?
The canonical SMILES for [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate is CC(=O)CCC(=O)OC(C)C(=O)COC(C)(C)C.
What is the InChIKey of [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate?
The InChIKey is BDBQSYVRBVTDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O5/c1-9(14)6-7-12(16)18-10(2)11(15)8-17-13(3,4)5/h10H,6-8H2,1-5H3.
What are the key properties of [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate?
[4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate has a molecular weight of 258.31 g/mol, XLogP of 1.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-methylpropan-2-yl)oxy]-3-oxobutan-2-yl] 4-oxopentanoate is sourced from PubChem (CID 157461813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).