C13H22O6 — CID 158535072
[2-oxo-2-(3-oxobutan-2-yloxy)ethyl] 2-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 158535072) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is [2-oxo-2-(3-oxobutan-2-yloxy)ethyl] 2-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | [2-oxo-2-(3-oxobutan-2-yloxy)ethyl] 2-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 158535072 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [2-oxo-2-(3-oxobutan-2-yloxy)ethyl] 2-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(=O)C(C)OC(=O)COC(=O)C(C)OC(C)(C)C |
| InChI | InChI=1S/C13H22O6/c1-8(14)9(2)18-11(15)7-17-12(16)10(3)19-13(4,5)6/h9-10H,7H2,1-6H3 |
| InChIKey | DBWPHFWVJSJYAZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |