About acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate
acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 143799381) has the molecular formula C18H24O5
and a molecular weight of 320.38 g/mol. Its IUPAC name is acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate.
Molecular Properties
| Compound Name | acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate |
| PubChem CID | 143799381 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | C#C.CC(OC(C)(C)C)C(=O)OCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O5.C2H2/c1-12(21-16(2,3)4)15(18)20-11-14(17)19-10-13-8-6-5-7-9-13;1-2/h5-9,12H,10-11H2,1-4H3;1-2H |
| InChIKey | HVAZRFUPVJOGLI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate?
The IUPAC name of acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate (CID 143799381) is acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate.
What is the SMILES notation for acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate?
The canonical SMILES for acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate is C#C.CC(OC(C)(C)C)C(=O)OCC(=O)OCc1ccccc1.
What is the InChIKey of acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate?
The InChIKey is HVAZRFUPVJOGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5.C2H2/c1-12(21-16(2,3)4)15(18)20-11-14(17)19-10-13-8-6-5-7-9-13;1-2/h5-9,12H,10-11H2,1-4H3;1-2H.
What are the key properties of acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate?
acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate has a molecular weight of 320.38 g/mol, XLogP of 2.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(2-oxo-2-phenylmethoxyethyl) 2-[(2-methylpropan-2-yl)oxy]propanoate is sourced from PubChem (CID 143799381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).