C18H24O7 — CID 142213101
[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-phenylmethoxypropanoate (PubChem CID 142213101) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is [2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-phenylmethoxypropanoate.
| Compound Name | [2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 142213101 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-2-oxoethyl] 2-phenylmethoxypropanoate |
| SMILES | CC(OCc1ccccc1)C(=O)OCC(=O)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24O7/c1-13(22-10-14-8-6-5-7-9-14)17(21)24-11-15(19)23-12-16(20)25-18(2,3)4/h5-9,13H,10-12H2,1-4H3 |
| InChIKey | ZAWNZFXIISFZEB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|