C17H27NO3 — CID 67771240
tert-butyl (3S)-3-amino-4-methyl-2-phenylmethoxypentanoate (PubChem CID 67771240) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-4-methyl-2-phenylmethoxypentanoate.
| Compound Name | tert-butyl (3S)-3-amino-4-methyl-2-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 67771240 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl (3S)-3-amino-4-methyl-2-phenylmethoxypentanoate |
| SMILES | CC(C)[C@H](N)C(OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-12(2)14(18)15(16(19)21-17(3,4)5)20-11-13-9-7-6-8-10-13/h6-10,12,14-15H,11,18H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | TVVVRRMHPOIXGO-MLCCFXAWSA-N |
| XLogP | 2.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |