About 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate
5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate (PubChem CID 58807583) has the molecular formula C14H22O10
and a molecular weight of 350.32 g/mol. Its IUPAC name is 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate.
Molecular Properties
| Compound Name | 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate |
| PubChem CID | 58807583 |
| Molecular Formula | C14H22O10 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate |
| SMILES | CC(OC(=O)CCCC(=O)OCCO)C(=O)OCC(=O)OCCO |
| InChI | InChI=1S/C14H22O10/c1-10(14(20)23-9-13(19)22-8-6-16)24-12(18)4-2-3-11(17)21-7-5-15/h10,15-16H,2-9H2,1H3 |
| InChIKey | LTAUJZKWRVRNSZ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate?
The IUPAC name of 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate (CID 58807583) is 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate.
What is the SMILES notation for 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate?
The canonical SMILES for 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate is CC(OC(=O)CCCC(=O)OCCO)C(=O)OCC(=O)OCCO.
What is the InChIKey of 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate?
The InChIKey is LTAUJZKWRVRNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O10/c1-10(14(20)23-9-13(19)22-8-6-16)24-12(18)4-2-3-11(17)21-7-5-15/h10,15-16H,2-9H2,1H3.
What are the key properties of 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate?
5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate has a molecular weight of 350.32 g/mol, XLogP of -1.30, 12 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-[1-[2-(2-hydroxyethoxy)-2-oxoethoxy]-1-oxopropan-2-yl] 1-O-(2-hydroxyethyl) pentanedioate is sourced from PubChem (CID 58807583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).