C12H18O9 — CID 58041440
4-[2-[1-(3-hydroxypropoxy)-1-oxopropan-2-yl]oxy-2-oxoethoxy]-4-oxobutanoic acid (PubChem CID 58041440) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is 4-[2-[1-(3-hydroxypropoxy)-1-oxopropan-2-yl]oxy-2-oxoethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[1-(3-hydroxypropoxy)-1-oxopropan-2-yl]oxy-2-oxoethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58041440 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[2-[1-(3-hydroxypropoxy)-1-oxopropan-2-yl]oxy-2-oxoethoxy]-4-oxobutanoic acid |
| SMILES | CC(OC(=O)COC(=O)CCC(=O)O)C(=O)OCCCO |
| InChI | InChI=1S/C12H18O9/c1-8(12(18)19-6-2-5-13)21-11(17)7-20-10(16)4-3-9(14)15/h8,13H,2-7H2,1H3,(H,14,15) |
| InChIKey | XPHSANORYCLHAW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|