C16H25O8- — CID 123651319
[2-oxo-2-(2-oxoethoxy)ethyl] 2-[2-(3-methylpentan-3-yloxy)propanoyloxy]propanoate (PubChem CID 123651319) has the molecular formula C16H25O8- and a molecular weight of 345.37 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoethoxy)ethyl] 2-[2-(3-methylpentan-3-yloxy)propanoyloxy]propanoate.
| Compound Name | [2-oxo-2-(2-oxoethoxy)ethyl] 2-[2-(3-methylpentan-3-yloxy)propanoyloxy]propanoate |
|---|---|
| PubChem CID | 123651319 |
| Molecular Formula | C16H25O8- |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [2-oxo-2-(2-oxoethoxy)ethyl] 2-[2-(3-methylpentan-3-yloxy)propanoyloxy]propanoate |
| SMILES | CCC(C)(CC)OC(C)C(=O)OC(C)C(=O)OCC(=O)OC[C-]=O |
| InChI | InChI=1S/C16H25O8/c1-6-16(5,7-2)24-12(4)15(20)23-11(3)14(19)22-10-13(18)21-9-8-17/h11-12H,6-7,9-10H2,1-5H3/q-1 |
| InChIKey | IUOLNFNCZJEWEE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|