C25H44O8 — CID 59391816
[8-[2-[2-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoyloxy]-3-oxooctan-2-yl] 2,3,3-trimethylbutanoate (PubChem CID 59391816) has the molecular formula C25H44O8 and a molecular weight of 472.62 g/mol. Its IUPAC name is [8-[2-[2-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoyloxy]-3-oxooctan-2-yl] 2,3,3-trimethylbutanoate.
| Compound Name | [8-[2-[2-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoyloxy]-3-oxooctan-2-yl] 2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 59391816 |
| Molecular Formula | C25H44O8 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | [8-[2-[2-[(2-methylpropan-2-yl)oxy]propanoyloxy]propanoyloxy]-3-oxooctan-2-yl] 2,3,3-trimethylbutanoate |
| SMILES | CC(OC(=O)C(C)C(C)(C)C)C(=O)CCCCCOC(=O)C(C)OC(=O)C(C)OC(C)(C)C |
| InChI | InChI=1S/C25H44O8/c1-16(24(5,6)7)21(27)31-17(2)20(26)14-12-11-13-15-30-22(28)18(3)32-23(29)19(4)33-25(8,9)10/h16-19H,11-15H2,1-10H3 |
| InChIKey | GHNACRBGPIWMBZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|