C26H30O7 — CID 174295066
[7-[2-(4-methylbenzoyl)oxypropanoyloxy]-3-oxoheptan-2-yl] 4-methylbenzoate (PubChem CID 174295066) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is [7-[2-(4-methylbenzoyl)oxypropanoyloxy]-3-oxoheptan-2-yl] 4-methylbenzoate.
| Compound Name | [7-[2-(4-methylbenzoyl)oxypropanoyloxy]-3-oxoheptan-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 174295066 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [7-[2-(4-methylbenzoyl)oxypropanoyloxy]-3-oxoheptan-2-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)C(=O)CCCCOC(=O)C(C)OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H30O7/c1-17-8-12-21(13-9-17)25(29)32-19(3)23(27)7-5-6-16-31-24(28)20(4)33-26(30)22-14-10-18(2)11-15-22/h8-15,19-20H,5-7,16H2,1-4H3 |
| InChIKey | HZBALOIFUCOHBZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|