C39H46O9 — CID 101265051
[4-[1-(1-butoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-nonanoylphenyl)benzoate (PubChem CID 101265051) has the molecular formula C39H46O9 and a molecular weight of 658.79 g/mol. Its IUPAC name is [4-[1-(1-butoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-nonanoylphenyl)benzoate.
| Compound Name | [4-[1-(1-butoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-nonanoylphenyl)benzoate |
|---|---|
| PubChem CID | 101265051 |
| Molecular Formula | C39H46O9 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | [4-[1-(1-butoxy-1-oxopropan-2-yl)oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-nonanoylphenyl)benzoate |
| SMILES | CCCCCCCCC(=O)c1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C)C(=O)OC(C)C(=O)OCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H46O9/c1-5-7-9-10-11-12-13-35(40)31-18-14-29(15-19-31)30-16-20-32(21-17-30)39(44)48-34-24-22-33(23-25-34)38(43)47-28(4)37(42)46-27(3)36(41)45-26-8-6-2/h14-25,27-28H,5-13,26H2,1-4H3 |
| InChIKey | ITVFEQDDMBTLTC-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|