C36H42O7 — CID 101242587
[4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-octanoylphenyl)benzoate (PubChem CID 101242587) has the molecular formula C36H42O7 and a molecular weight of 586.73 g/mol. Its IUPAC name is [4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-octanoylphenyl)benzoate.
| Compound Name | [4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-octanoylphenyl)benzoate |
|---|---|
| PubChem CID | 101242587 |
| Molecular Formula | C36H42O7 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | [4-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-octanoylphenyl)benzoate |
| SMILES | CCCCCCCC(=O)c1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C)C(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H42O7/c1-5-7-8-9-10-11-33(37)29-16-12-27(13-17-29)28-14-18-30(19-15-28)36(40)43-32-22-20-31(21-23-32)35(39)42-26(4)34(38)41-24-25(3)6-2/h12-23,25-26H,5-11,24H2,1-4H3 |
| InChIKey | XRYMLXCDDPBMMQ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|