About [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate
[4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate (PubChem CID 14495517) has the molecular formula C28H38O3
and a molecular weight of 422.61 g/mol. Its IUPAC name is [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate.
Molecular Properties
| Compound Name | [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate |
| PubChem CID | 14495517 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate |
| SMILES | CCCCCCCCC(=O)c1ccc(-c2ccc(OC(=O)CCC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C28H38O3/c1-4-6-7-8-9-10-11-27(29)25-15-13-23(14-16-25)24-17-19-26(20-18-24)31-28(30)21-12-22(3)5-2/h13-20,22H,4-12,21H2,1-3H3 |
| InChIKey | XBLXVSNFELXFLL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate?
The IUPAC name of [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate (CID 14495517) is [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate.
What is the SMILES notation for [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate?
The canonical SMILES for [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate is CCCCCCCCC(=O)c1ccc(-c2ccc(OC(=O)CCC(C)CC)cc2)cc1.
What is the InChIKey of [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate?
The InChIKey is XBLXVSNFELXFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38O3/c1-4-6-7-8-9-10-11-27(29)25-15-13-23(14-16-25)24-17-19-26(20-18-24)31-28(30)21-12-22(3)5-2/h13-20,22H,4-12,21H2,1-3H3.
What are the key properties of [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate?
[4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate has a molecular weight of 422.61 g/mol, XLogP of 8.02, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-nonanoylphenyl)phenyl] 4-methylhexanoate is sourced from PubChem (CID 14495517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).