C42H50O13 — CID 102071880
[4-[1-[1-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate (PubChem CID 102071880) has the molecular formula C42H50O13 and a molecular weight of 762.85 g/mol. Its IUPAC name is [4-[1-[1-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate.
| Compound Name | [4-[1-[1-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate |
|---|---|
| PubChem CID | 102071880 |
| Molecular Formula | C42H50O13 |
| Molecular Weight | 762.85 g/mol |
| Exact Mass | 762.33 |
| IUPAC Name | [4-[1-[1-[1-[1-(2-methylbutoxy)-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-(4-pentoxyphenyl)benzoate |
| SMILES | CCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C)C(=O)OC(C)C(=O)OC(C)C(=O)OC(C)C(=O)OCC(C)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H50O13/c1-8-10-11-24-49-35-20-16-32(17-21-35)31-12-14-33(15-13-31)42(48)55-36-22-18-34(19-23-36)41(47)54-30(7)40(46)53-29(6)39(45)52-28(5)38(44)51-27(4)37(43)50-25-26(3)9-2/h12-23,26-30H,8-11,24-25H2,1-7H3 |
| InChIKey | ADXUOSJHADSOPZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.85 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|