C22H38N2O10 — CID 157304502
[1-[methyl(2-oxopropyl)amino]-1-oxopropan-2-yl] 2-methoxypropanoate (PubChem CID 157304502) has the molecular formula C22H38N2O10 and a molecular weight of 490.55 g/mol. Its IUPAC name is [1-[methyl(2-oxopropyl)amino]-1-oxopropan-2-yl] 2-methoxypropanoate.
| Compound Name | [1-[methyl(2-oxopropyl)amino]-1-oxopropan-2-yl] 2-methoxypropanoate |
|---|---|
| PubChem CID | 157304502 |
| Molecular Formula | C22H38N2O10 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [1-[methyl(2-oxopropyl)amino]-1-oxopropan-2-yl] 2-methoxypropanoate |
| SMILES | COC(C)C(=O)OC(C)C(=O)N(C)CC(C)=O.COC(C)C(=O)OC(C)C(=O)N(C)CC(C)=O |
| InChI | InChI=1S/2C11H19NO5/c2*1-7(13)6-12(4)10(14)8(2)17-11(15)9(3)16-5/h2*8-9H,6H2,1-5H3 |
| InChIKey | BCHIWQHLZVYZBP-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |