C11H18O15 — CID 158069750
(2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;3-(hydroxymethoxy)-3-oxopropanoic acid;hydroxymethyl hydrogen carbonate (PubChem CID 158069750) has the molecular formula C11H18O15 and a molecular weight of 390.25 g/mol. Its IUPAC name is (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;3-(hydroxymethoxy)-3-oxopropanoic acid;hydroxymethyl hydrogen carbonate.
| Compound Name | (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;3-(hydroxymethoxy)-3-oxopropanoic acid;hydroxymethyl hydrogen carbonate |
|---|---|
| PubChem CID | 158069750 |
| Molecular Formula | C11H18O15 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;3-(hydroxymethoxy)-3-oxopropanoic acid;hydroxymethyl hydrogen carbonate |
| SMILES | O=C(CO)OCOC(=O)CO.O=C(O)CC(=O)OCO.O=C(O)OCO |
| InChI | InChI=1S/C5H8O6.C4H6O5.C2H4O4/c6-1-4(8)10-3-11-5(9)2-7;5-2-9-4(8)1-3(6)7;3-1-6-2(4)5/h6-7H,1-3H2;5H,1-2H2,(H,6,7);3H,1H2,(H,4,5) |
| InChIKey | FLRJLTQTTDQMJG-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 243.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|