About (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane
(2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane (PubChem CID 161332645) has the molecular formula C11H32O6
and a molecular weight of 260.37 g/mol. Its IUPAC name is (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane.
Molecular Properties
| Compound Name | (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane |
| PubChem CID | 161332645 |
| Molecular Formula | C11H32O6 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane |
| SMILES | C.C.C.C.C.C.O=C(CO)OCOC(=O)CO |
| InChI | InChI=1S/C5H8O6.6CH4/c6-1-4(8)10-3-11-5(9)2-7;;;;;;/h6-7H,1-3H2;6*1H4 |
| InChIKey | VLPXARXGGHNDNZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane?
The IUPAC name of (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane (CID 161332645) is (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane.
What is the SMILES notation for (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane?
The canonical SMILES for (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane is C.C.C.C.C.C.O=C(CO)OCOC(=O)CO.
What is the InChIKey of (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane?
The InChIKey is VLPXARXGGHNDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O6.6CH4/c6-1-4(8)10-3-11-5(9)2-7;;;;;;/h6-7H,1-3H2;6*1H4.
What are the key properties of (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane?
(2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane has a molecular weight of 260.37 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyacetyl)oxymethyl 2-hydroxyacetate;methane is sourced from PubChem (CID 161332645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).