C9H20O8 — CID 163645846
ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane (PubChem CID 163645846) has the molecular formula C9H20O8 and a molecular weight of 256.25 g/mol. Its IUPAC name is ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane.
| Compound Name | ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane |
|---|---|
| PubChem CID | 163645846 |
| Molecular Formula | C9H20O8 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane |
| SMILES | C.O=C(CO)OCCOC(=O)CO.OCCO |
| InChI | InChI=1S/C6H10O6.C2H6O2.CH4/c7-3-5(9)11-1-2-12-6(10)4-8;3-1-2-4;/h7-8H,1-4H2;3-4H,1-2H2;1H4 |
| InChIKey | IIDQBAIPORNZLK-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|