About ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane
ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane (PubChem CID 163645846) has the molecular formula C9H20O8
and a molecular weight of 256.25 g/mol. Its IUPAC name is ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane.
Molecular Properties
| Compound Name | ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane |
| PubChem CID | 163645846 |
| Molecular Formula | C9H20O8 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane |
| SMILES | C.O=C(CO)OCCOC(=O)CO.OCCO |
| InChI | InChI=1S/C6H10O6.C2H6O2.CH4/c7-3-5(9)11-1-2-12-6(10)4-8;3-1-2-4;/h7-8H,1-4H2;3-4H,1-2H2;1H4 |
| InChIKey | IIDQBAIPORNZLK-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane?
The IUPAC name of ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane (CID 163645846) is ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane.
What is the SMILES notation for ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane?
The canonical SMILES for ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane is C.O=C(CO)OCCOC(=O)CO.OCCO.
What is the InChIKey of ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane?
The InChIKey is IIDQBAIPORNZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O6.C2H6O2.CH4/c7-3-5(9)11-1-2-12-6(10)4-8;3-1-2-4;/h7-8H,1-4H2;3-4H,1-2H2;1H4.
What are the key properties of ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane?
ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane has a molecular weight of 256.25 g/mol, XLogP of -2.34, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;2-(2-hydroxyacetyl)oxyethyl 2-hydroxyacetate;methane is sourced from PubChem (CID 163645846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).