C7H16N2O5 — CID 175507272
1,1,3-tris(hydroxymethyl)-3-(3-hydroxypropyl)urea (PubChem CID 175507272) has the molecular formula C7H16N2O5 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1,1,3-tris(hydroxymethyl)-3-(3-hydroxypropyl)urea.
| Compound Name | 1,1,3-tris(hydroxymethyl)-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 175507272 |
| Molecular Formula | C7H16N2O5 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1,1,3-tris(hydroxymethyl)-3-(3-hydroxypropyl)urea |
| SMILES | O=C(N(CO)CO)N(CO)CCCO |
| InChI | InChI=1S/C7H16N2O5/c10-3-1-2-8(4-11)7(14)9(5-12)6-13/h10-13H,1-6H2 |
| InChIKey | HNTAGCSNMODVFF-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|