C14H28N2O5S — CID 171384810
2-[bis(3-hydroxypropyl)amino]-N,N-bis(3-hydroxypropyl)-2-sulfanylideneacetamide (PubChem CID 171384810) has the molecular formula C14H28N2O5S and a molecular weight of 336.45 g/mol. Its IUPAC name is 2-[bis(3-hydroxypropyl)amino]-N,N-bis(3-hydroxypropyl)-2-sulfanylideneacetamide.
| Compound Name | 2-[bis(3-hydroxypropyl)amino]-N,N-bis(3-hydroxypropyl)-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 171384810 |
| Molecular Formula | C14H28N2O5S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[bis(3-hydroxypropyl)amino]-N,N-bis(3-hydroxypropyl)-2-sulfanylideneacetamide |
| SMILES | O=C(C(=S)N(CCCO)CCCO)N(CCCO)CCCO |
| InChI | InChI=1S/C14H28N2O5S/c17-9-1-5-15(6-2-10-18)13(21)14(22)16(7-3-11-19)8-4-12-20/h17-20H,1-12H2 |
| InChIKey | ILJZKEHOGIUQBQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|