C7H14KNO2S2 — CID 169087773
potassium N,N-bis(3-hydroxypropyl)carbamodithioate (PubChem CID 169087773) has the molecular formula C7H14KNO2S2 and a molecular weight of 247.43 g/mol. Its IUPAC name is potassium N,N-bis(3-hydroxypropyl)carbamodithioate.
| Compound Name | potassium N,N-bis(3-hydroxypropyl)carbamodithioate |
|---|---|
| PubChem CID | 169087773 |
| Molecular Formula | C7H14KNO2S2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | potassium N,N-bis(3-hydroxypropyl)carbamodithioate |
| SMILES | OCCCN(CCCO)C(=S)[S-].[K+] |
| InChI | InChI=1S/C7H15NO2S2.K/c9-5-1-3-8(7(11)12)4-2-6-10;/h9-10H,1-6H2,(H,11,12);/q;+1/p-1 |
| InChIKey | FVBRCCLORPTSET-UHFFFAOYSA-M |
| XLogP | -3.11 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|