C5H10NO2S2- — CID 4524302
N,N-bis(2-hydroxyethyl)carbamodithioate (PubChem CID 4524302) has the molecular formula C5H10NO2S2- and a molecular weight of 180.27 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)carbamodithioate.
| Compound Name | N,N-bis(2-hydroxyethyl)carbamodithioate |
|---|---|
| PubChem CID | 4524302 |
| Molecular Formula | C5H10NO2S2- |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)carbamodithioate |
| SMILES | OCCN(CCO)C(=S)[S-] |
| InChI | InChI=1S/C5H11NO2S2/c7-3-1-6(2-4-8)5(9)10/h7-8H,1-4H2,(H,9,10)/p-1 |
| InChIKey | PCBLZWZCGNKODY-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|