C12H15F2N — CID 107514676
(E)-4-(2,3-difluoro-4-methylphenyl)-N-methylbut-3-en-1-amine (PubChem CID 107514676) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is (E)-4-(2,3-difluoro-4-methylphenyl)-N-methylbut-3-en-1-amine.
| Compound Name | (E)-4-(2,3-difluoro-4-methylphenyl)-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 107514676 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (E)-4-(2,3-difluoro-4-methylphenyl)-N-methylbut-3-en-1-amine |
| SMILES | CNCC/C=C/c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C12H15F2N/c1-9-6-7-10(12(14)11(9)13)5-3-4-8-15-2/h3,5-7,15H,4,8H2,1-2H3/b5-3+ |
| InChIKey | XAWMEXNXWBLVJR-HWKANZROSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|