C32H28F6O — CID 143772889
4,5-difluoro-7-methyl-3-[(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10-tetramethylidene-13-prop-2-enoxytetradeca-1,3,7,11,13-pentaen-2-yl]-1,2-dihydronaphthalene (PubChem CID 143772889) has the molecular formula C32H28F6O and a molecular weight of 542.56 g/mol. Its IUPAC name is 4,5-difluoro-7-methyl-3-[(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10-tetramethylidene-13-prop-2-enoxytetradeca-1,3,7,11,13-pentaen-2-yl]-1,2-dihydronaphthalene.
| Compound Name | 4,5-difluoro-7-methyl-3-[(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10-tetramethylidene-13-prop-2-enoxytetradeca-1,3,7,11,13-pentaen-2-yl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 143772889 |
| Molecular Formula | C32H28F6O |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4,5-difluoro-7-methyl-3-[(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10-tetramethylidene-13-prop-2-enoxytetradeca-1,3,7,11,13-pentaen-2-yl]-1,2-dihydronaphthalene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C1=C(F)c2c(F)cc(C)cc2CC1 |
| InChI | InChI=1S/C32H28F6O/c1-9-14-39-23(8)31(37)29(35)21(6)19(4)11-10-18(3)20(5)28(34)30(36)22(7)25-13-12-24-15-17(2)16-26(33)27(24)32(25)38/h9-11,15-16H,1,3-8,12-14H2,2H3/b11-10-,30-28-,31-29- |
| InChIKey | HBJRPOKIZJMBSU-LYJAVVILSA-N |
| XLogP | 10.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|