C20H18F4O — CID 143875098
1-[(3Z,7Z)-7,8-difluoro-9-methyl-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-2,3-difluorobenzene (PubChem CID 143875098) has the molecular formula C20H18F4O and a molecular weight of 350.36 g/mol. Its IUPAC name is 1-[(3Z,7Z)-7,8-difluoro-9-methyl-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-2,3-difluorobenzene.
| Compound Name | 1-[(3Z,7Z)-7,8-difluoro-9-methyl-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 143875098 |
| Molecular Formula | C20H18F4O |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(3Z,7Z)-7,8-difluoro-9-methyl-2,5,6-trimethylidenedeca-3,7,9-trienoxy]-2,3-difluorobenzene |
| SMILES | C=C(/C=C/C(=C)C(=C)/C(F)=C(/F)C(=C)C)COc1cccc(F)c1F |
| InChI | InChI=1S/C20H18F4O/c1-12(2)18(22)19(23)15(5)14(4)10-9-13(3)11-25-17-8-6-7-16(21)20(17)24/h6-10H,1,3-5,11H2,2H3/b10-9-,19-18- |
| InChIKey | QVLJFBZJQLZJGG-DEXHTJMYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|