C16H18F2O2 — CID 145339808
1-[(Z)-2,5-dimethylidenehept-3-enoxy]-2,3-difluoro-4-methoxybenzene (PubChem CID 145339808) has the molecular formula C16H18F2O2 and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-[(Z)-2,5-dimethylidenehept-3-enoxy]-2,3-difluoro-4-methoxybenzene.
| Compound Name | 1-[(Z)-2,5-dimethylidenehept-3-enoxy]-2,3-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 145339808 |
| Molecular Formula | C16H18F2O2 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-[(Z)-2,5-dimethylidenehept-3-enoxy]-2,3-difluoro-4-methoxybenzene |
| SMILES | C=C(/C=C\C(=C)COc1ccc(OC)c(F)c1F)CC |
| InChI | InChI=1S/C16H18F2O2/c1-5-11(2)6-7-12(3)10-20-14-9-8-13(19-4)15(17)16(14)18/h6-9H,2-3,5,10H2,1,4H3/b7-6- |
| InChIKey | ICTHRMBRQQUSHW-SREVYHEPSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|