C10H11F2NO2 — CID 166159422
(Z)-1-(2,3-difluorophenoxy)-N-methoxypropan-2-imine (PubChem CID 166159422) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is (Z)-1-(2,3-difluorophenoxy)-N-methoxypropan-2-imine.
| Compound Name | (Z)-1-(2,3-difluorophenoxy)-N-methoxypropan-2-imine |
|---|---|
| PubChem CID | 166159422 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (Z)-1-(2,3-difluorophenoxy)-N-methoxypropan-2-imine |
| SMILES | CO/N=C(/C)COc1cccc(F)c1F |
| InChI | InChI=1S/C10H11F2NO2/c1-7(13-14-2)6-15-9-5-3-4-8(11)10(9)12/h3-5H,6H2,1-2H3/b13-7- |
| InChIKey | YAVNZUVOHLONIR-QPEQYQDCSA-N |
| XLogP | 2.37 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|