C9H7ClF2O — CID 130719015
1-(2-chloroprop-2-enoxy)-2,3-difluorobenzene (PubChem CID 130719015) has the molecular formula C9H7ClF2O and a molecular weight of 204.60 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enoxy)-2,3-difluorobenzene.
| Compound Name | 1-(2-chloroprop-2-enoxy)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 130719015 |
| Molecular Formula | C9H7ClF2O |
| Molecular Weight | 204.60 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 1-(2-chloroprop-2-enoxy)-2,3-difluorobenzene |
| SMILES | C=C(Cl)COc1cccc(F)c1F |
| InChI | InChI=1S/C9H7ClF2O/c1-6(10)5-13-8-4-2-3-7(11)9(8)12/h2-4H,1,5H2 |
| InChIKey | SYDZSMPUDLRZTH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |