C24H25F3O — CID 143875063
1-ethenyl-4-[(4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorobenzene (PubChem CID 143875063) has the molecular formula C24H25F3O and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-ethenyl-4-[(4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorobenzene.
| Compound Name | 1-ethenyl-4-[(4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 143875063 |
| Molecular Formula | C24H25F3O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-ethenyl-4-[(4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorobenzene |
| SMILES | C=Cc1ccc(CCC(=C)/C=C\C(=C)C(=C)/C(F)=C/C(=C)OCC)c(F)c1F |
| InChI | InChI=1S/C24H25F3O/c1-7-20-13-14-21(24(27)23(20)26)12-10-16(3)9-11-17(4)19(6)22(25)15-18(5)28-8-2/h7,9,11,13-15H,1,3-6,8,10,12H2,2H3/b11-9-,22-15+ |
| InChIKey | HROBXYHYKOTCQT-NIKSBTOOSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|