C26H25F3N2O — CID 143908883
2-[2,3-difluoro-4-[(4Z,8E)-9-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]phenyl]-5-methylpyrimidine (PubChem CID 143908883) has the molecular formula C26H25F3N2O and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[(4Z,8E)-9-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]phenyl]-5-methylpyrimidine.
| Compound Name | 2-[2,3-difluoro-4-[(4Z,8E)-9-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]phenyl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 143908883 |
| Molecular Formula | C26H25F3N2O |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[2,3-difluoro-4-[(4Z,8E)-9-fluoro-10-methoxy-3,6,7-trimethylideneundeca-4,8,10-trienyl]phenyl]-5-methylpyrimidine |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(\F)C(=C)OC)CCc1ccc(-c2ncc(C)cn2)c(F)c1F |
| InChI | InChI=1S/C26H25F3N2O/c1-16(7-9-18(3)19(4)13-23(27)20(5)32-6)8-10-21-11-12-22(25(29)24(21)28)26-30-14-17(2)15-31-26/h7,9,11-15H,1,3-5,8,10H2,2,6H3/b9-7-,23-13+ |
| InChIKey | MRVFWPWECJFATI-MPJJLERJSA-N |
| XLogP | 6.90 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|