C22H23F3O2 — CID 143875123
4-[(4Z,8E)-10-ethoxy-9-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorophenol (PubChem CID 143875123) has the molecular formula C22H23F3O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[(4Z,8E)-10-ethoxy-9-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorophenol.
| Compound Name | 4-[(4Z,8E)-10-ethoxy-9-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 143875123 |
| Molecular Formula | C22H23F3O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-[(4Z,8E)-10-ethoxy-9-fluoro-3,6,7-trimethylideneundeca-4,8,10-trienyl]-2,3-difluorophenol |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(\F)C(=C)OCC)CCc1ccc(O)c(F)c1F |
| InChI | InChI=1S/C22H23F3O2/c1-6-27-17(5)19(23)13-16(4)15(3)9-7-14(2)8-10-18-11-12-20(26)22(25)21(18)24/h7,9,11-13,26H,2-6,8,10H2,1H3/b9-7-,19-13+ |
| InChIKey | IRTLHOUJLPMAFF-XEIPBFEBSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|