C28H35F3O2 — CID 143909461
4-[4-[4-[(1E,4E)-6-ethoxy-5-fluoro-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]-2,3-difluorophenyl]cyclohexan-1-ol (PubChem CID 143909461) has the molecular formula C28H35F3O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 4-[4-[4-[(1E,4E)-6-ethoxy-5-fluoro-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]-2,3-difluorophenyl]cyclohexan-1-ol.
| Compound Name | 4-[4-[4-[(1E,4E)-6-ethoxy-5-fluoro-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]-2,3-difluorophenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143909461 |
| Molecular Formula | C28H35F3O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 4-[4-[4-[(1E,4E)-6-ethoxy-5-fluoro-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]-2,3-difluorophenyl]cyclohexan-1-ol |
| SMILES | C=C(/C=C(\F)C(=C)OCC)/C=C/C1CCC(c2ccc(C3CCC(O)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C28H35F3O2/c1-4-33-19(3)26(29)17-18(2)5-6-20-7-9-21(10-8-20)24-15-16-25(28(31)27(24)30)22-11-13-23(32)14-12-22/h5-6,15-17,20-23,32H,2-4,7-14H2,1H3/b6-5+,26-17+ |
| InChIKey | NEFGPENTZIQLMO-NBUOHMEYSA-N |
| XLogP | 7.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|