C30H39F3O2 — CID 143909092
4-[2,3-difluoro-4-[4-[(1E,4E)-5-fluoro-6-methoxy-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]phenyl]cyclohexan-1-ol;prop-1-ene (PubChem CID 143909092) has the molecular formula C30H39F3O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-[4-[(1E,4E)-5-fluoro-6-methoxy-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]phenyl]cyclohexan-1-ol;prop-1-ene.
| Compound Name | 4-[2,3-difluoro-4-[4-[(1E,4E)-5-fluoro-6-methoxy-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]phenyl]cyclohexan-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 143909092 |
| Molecular Formula | C30H39F3O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 4-[2,3-difluoro-4-[4-[(1E,4E)-5-fluoro-6-methoxy-3-methylidenehepta-1,4,6-trienyl]cyclohexyl]phenyl]cyclohexan-1-ol;prop-1-ene |
| SMILES | C=C(/C=C(\F)C(=C)OC)/C=C/C1CCC(c2ccc(C3CCC(O)CC3)c(F)c2F)CC1.C=CC |
| InChI | InChI=1S/C27H33F3O2.C3H6/c1-17(16-25(28)18(2)32-3)4-5-19-6-8-20(9-7-19)23-14-15-24(27(30)26(23)29)21-10-12-22(31)13-11-21;1-3-2/h4-5,14-16,19-22,31H,1-2,6-13H2,3H3;3H,1H2,2H3/b5-4+,25-16+; |
| InChIKey | LIESHJLYONHBIN-WCOJQKIXSA-N |
| XLogP | 8.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|