C21H26F2O — CID 143776964
1-(2,5-dimethylhexoxy)-2,3-difluoro-4-(4-methylphenyl)benzene (PubChem CID 143776964) has the molecular formula C21H26F2O and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(2,5-dimethylhexoxy)-2,3-difluoro-4-(4-methylphenyl)benzene.
| Compound Name | 1-(2,5-dimethylhexoxy)-2,3-difluoro-4-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 143776964 |
| Molecular Formula | C21H26F2O |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-(2,5-dimethylhexoxy)-2,3-difluoro-4-(4-methylphenyl)benzene |
| SMILES | Cc1ccc(-c2ccc(OCC(C)CCC(C)C)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H26F2O/c1-14(2)5-6-16(4)13-24-19-12-11-18(20(22)21(19)23)17-9-7-15(3)8-10-17/h7-12,14,16H,5-6,13H2,1-4H3 |
| InChIKey | GBABSMWGBDJKPB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |