C30H36F2O3 — CID 102130248
6-[4-[2,3-difluoro-4-[4-(4-methylpentoxy)phenyl]phenyl]phenoxy]hexan-1-ol (PubChem CID 102130248) has the molecular formula C30H36F2O3 and a molecular weight of 482.61 g/mol. Its IUPAC name is 6-[4-[2,3-difluoro-4-[4-(4-methylpentoxy)phenyl]phenyl]phenoxy]hexan-1-ol.
| Compound Name | 6-[4-[2,3-difluoro-4-[4-(4-methylpentoxy)phenyl]phenyl]phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 102130248 |
| Molecular Formula | C30H36F2O3 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 6-[4-[2,3-difluoro-4-[4-(4-methylpentoxy)phenyl]phenyl]phenoxy]hexan-1-ol |
| SMILES | CC(C)CCCOc1ccc(-c2ccc(-c3ccc(OCCCCCCO)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H36F2O3/c1-22(2)8-7-21-35-26-15-11-24(12-16-26)28-18-17-27(29(31)30(28)32)23-9-13-25(14-10-23)34-20-6-4-3-5-19-33/h9-18,22,33H,3-8,19-21H2,1-2H3 |
| InChIKey | PYWDCKKNYXHUHP-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|