C28H36F2 — CID 77417239
1-[4-(4-but-3-enylcyclohex-3-en-1-yl)but-3-enyl]-4-(4-ethylcyclohexen-1-yl)-2,3-difluorobenzene (PubChem CID 77417239) has the molecular formula C28H36F2 and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-[4-(4-but-3-enylcyclohex-3-en-1-yl)but-3-enyl]-4-(4-ethylcyclohexen-1-yl)-2,3-difluorobenzene.
| Compound Name | 1-[4-(4-but-3-enylcyclohex-3-en-1-yl)but-3-enyl]-4-(4-ethylcyclohexen-1-yl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 77417239 |
| Molecular Formula | C28H36F2 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 1-[4-(4-but-3-enylcyclohex-3-en-1-yl)but-3-enyl]-4-(4-ethylcyclohexen-1-yl)-2,3-difluorobenzene |
| SMILES | C=CCCC1=CCC(C=CCCc2ccc(C3=CCC(CC)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C28H36F2/c1-3-5-8-22-11-13-23(14-12-22)9-6-7-10-25-19-20-26(28(30)27(25)29)24-17-15-21(4-2)16-18-24/h3,6,9,11,17,19-21,23H,1,4-5,7-8,10,12-16,18H2,2H3 |
| InChIKey | VXVBWZUVMZGMMM-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|