C32H34F2O — CID 77417280
2,3-difluoro-1-methoxy-4-[4-[4-[4-(4-propylphenyl)phenyl]but-1-enyl]cyclohexen-1-yl]benzene (PubChem CID 77417280) has the molecular formula C32H34F2O and a molecular weight of 472.62 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-[4-[4-[4-(4-propylphenyl)phenyl]but-1-enyl]cyclohexen-1-yl]benzene.
| Compound Name | 2,3-difluoro-1-methoxy-4-[4-[4-[4-(4-propylphenyl)phenyl]but-1-enyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 77417280 |
| Molecular Formula | C32H34F2O |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-[4-[4-[4-(4-propylphenyl)phenyl]but-1-enyl]cyclohexen-1-yl]benzene |
| SMILES | CCCc1ccc(-c2ccc(CCC=CC3CC=C(c4ccc(OC)c(F)c4F)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H34F2O/c1-3-6-23-9-15-26(16-10-23)27-17-11-24(12-18-27)7-4-5-8-25-13-19-28(20-14-25)29-21-22-30(35-2)32(34)31(29)33/h5,8-12,15-19,21-22,25H,3-4,6-7,13-14,20H2,1-2H3 |
| InChIKey | LNZQIURHEQAWCJ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|