C14H20F2 — CID 123274263
1-(3-ethylpentyl)-2,3-difluoro-4-methylbenzene (PubChem CID 123274263) has the molecular formula C14H20F2 and a molecular weight of 226.31 g/mol. Its IUPAC name is 1-(3-ethylpentyl)-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-(3-ethylpentyl)-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 123274263 |
| Molecular Formula | C14H20F2 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1-(3-ethylpentyl)-2,3-difluoro-4-methylbenzene |
| SMILES | CCC(CC)CCc1ccc(C)c(F)c1F |
| InChI | InChI=1S/C14H20F2/c1-4-11(5-2)7-9-12-8-6-10(3)13(15)14(12)16/h6,8,11H,4-5,7,9H2,1-3H3 |
| InChIKey | YNOSHTSKJFZSCP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |