C15H11F5 — CID 155200965
2,3-difluoro-1-methyl-4-[2-(2,4,5-trifluorophenyl)ethyl]benzene (PubChem CID 155200965) has the molecular formula C15H11F5 and a molecular weight of 286.24 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[2-(2,4,5-trifluorophenyl)ethyl]benzene.
| Compound Name | 2,3-difluoro-1-methyl-4-[2-(2,4,5-trifluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 155200965 |
| Molecular Formula | C15H11F5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[2-(2,4,5-trifluorophenyl)ethyl]benzene |
| SMILES | Cc1ccc(CCc2cc(F)c(F)cc2F)c(F)c1F |
| InChI | InChI=1S/C15H11F5/c1-8-2-3-9(15(20)14(8)19)4-5-10-6-12(17)13(18)7-11(10)16/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | OXPJGHZUVDSMJC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|